C20H17N3O4 — CID 4271764
methyl 2-[5-[(phenylcarbamoylhydrazinylidene)methyl]furan-2-yl]benzoate (PubChem CID 4271764) has the molecular formula C20H17N3O4 and a molecular weight of 363.37 g/mol. Its IUPAC name is methyl 2-[5-[(phenylcarbamoylhydrazinylidene)methyl]furan-2-yl]benzoate.
| Compound Name | methyl 2-[5-[(phenylcarbamoylhydrazinylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 4271764 |
| Molecular Formula | C20H17N3O4 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | methyl 2-[5-[(phenylcarbamoylhydrazinylidene)methyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccccc1-c1ccc(C=NNC(=O)Nc2ccccc2)o1 |
| InChI | InChI=1S/C20H17N3O4/c1-26-19(24)17-10-6-5-9-16(17)18-12-11-15(27-18)13-21-23-20(25)22-14-7-3-2-4-8-14/h2-13H,1H3,(H2,22,23,25) |
| InChIKey | HEYQRNBSKAYEED-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|