C19H13ClN3O4- — CID 172958492
4-chloro-3-[5-[(E)-(phenylcarbamoylhydrazinylidene)methyl]furan-2-yl]benzoate (PubChem CID 172958492) has the molecular formula C19H13ClN3O4- and a molecular weight of 382.78 g/mol. Its IUPAC name is 4-chloro-3-[5-[(E)-(phenylcarbamoylhydrazinylidene)methyl]furan-2-yl]benzoate.
| Compound Name | 4-chloro-3-[5-[(E)-(phenylcarbamoylhydrazinylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 172958492 |
| Molecular Formula | C19H13ClN3O4- |
| Molecular Weight | 382.78 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 4-chloro-3-[5-[(E)-(phenylcarbamoylhydrazinylidene)methyl]furan-2-yl]benzoate |
| SMILES | O=C(N/N=C/c1ccc(-c2cc(C(=O)[O-])ccc2Cl)o1)Nc1ccccc1 |
| InChI | InChI=1S/C19H14ClN3O4/c20-16-8-6-12(18(24)25)10-15(16)17-9-7-14(27-17)11-21-23-19(26)22-13-4-2-1-3-5-13/h1-11H,(H,24,25)(H2,22,23,26)/p-1/b21-11+ |
| InChIKey | YVENNRKVELTSGJ-SRZZPIQSSA-M |
| XLogP | 3.12 |
| TPSA | 106.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.78 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|