C14H17NO2 — CID 102299494
3-hexyl-1,4-benzoxazin-2-one (PubChem CID 102299494) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is 3-hexyl-1,4-benzoxazin-2-one.
| Compound Name | 3-hexyl-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 102299494 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 3-hexyl-1,4-benzoxazin-2-one |
| SMILES | CCCCCCc1nc2ccccc2oc1=O |
| InChI | InChI=1S/C14H17NO2/c1-2-3-4-5-9-12-14(16)17-13-10-7-6-8-11(13)15-12/h6-8,10H,2-5,9H2,1H3 |
| InChIKey | RGCWWKDSQLXCOK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|