C15H11NO4S — CID 802681
3-(benzenesulfonylmethyl)-1,4-benzoxazin-2-one (PubChem CID 802681) has the molecular formula C15H11NO4S and a molecular weight of 301.32 g/mol. Its IUPAC name is 3-(benzenesulfonylmethyl)-1,4-benzoxazin-2-one.
| Compound Name | 3-(benzenesulfonylmethyl)-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 802681 |
| Molecular Formula | C15H11NO4S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 3-(benzenesulfonylmethyl)-1,4-benzoxazin-2-one |
| SMILES | O=c1oc2ccccc2nc1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H11NO4S/c17-15-13(16-12-8-4-5-9-14(12)20-15)10-21(18,19)11-6-2-1-3-7-11/h1-9H,10H2 |
| InChIKey | MDSONESFKLNITK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 77.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |