C7H5AgNO4S — CID 160787540
1,3-benzoxazole-2-sulfonic acid;silver (PubChem CID 160787540) has the molecular formula C7H5AgNO4S and a molecular weight of 307.06 g/mol. Its IUPAC name is 1,3-benzoxazole-2-sulfonic acid;silver.
| Compound Name | 1,3-benzoxazole-2-sulfonic acid;silver |
|---|---|
| PubChem CID | 160787540 |
| Molecular Formula | C7H5AgNO4S |
| Molecular Weight | 307.06 g/mol |
| Exact Mass | 305.90 |
| IUPAC Name | 1,3-benzoxazole-2-sulfonic acid;silver |
| SMILES | O=S(=O)(O)c1nc2ccccc2o1.[Ag] |
| InChI | InChI=1S/C7H5NO4S.Ag/c9-13(10,11)7-8-5-3-1-2-4-6(5)12-7;/h1-4H,(H,9,10,11); |
| InChIKey | SBKDMVAZOHIMSZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.06 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|