C8H4F3NO3S — CID 154146633
2-(trifluoromethylsulfonyl)-1,3-benzoxazole (PubChem CID 154146633) has the molecular formula C8H4F3NO3S and a molecular weight of 251.19 g/mol. Its IUPAC name is 2-(trifluoromethylsulfonyl)-1,3-benzoxazole.
| Compound Name | 2-(trifluoromethylsulfonyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 154146633 |
| Molecular Formula | C8H4F3NO3S |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 250.99 |
| IUPAC Name | 2-(trifluoromethylsulfonyl)-1,3-benzoxazole |
| SMILES | O=S(=O)(c1nc2ccccc2o1)C(F)(F)F |
| InChI | InChI=1S/C8H4F3NO3S/c9-8(10,11)16(13,14)7-12-5-3-1-2-4-6(5)15-7/h1-4H |
| InChIKey | BDVYWFHHFRMHNA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |