C10H4F7NO — CID 87259215
2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3-benzoxazole (PubChem CID 87259215) has the molecular formula C10H4F7NO and a molecular weight of 287.13 g/mol. Its IUPAC name is 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3-benzoxazole.
| Compound Name | 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 87259215 |
| Molecular Formula | C10H4F7NO |
| Molecular Weight | 287.13 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 2-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,3-benzoxazole |
| SMILES | FC(F)(F)C(F)(c1nc2ccccc2o1)C(F)(F)F |
| InChI | InChI=1S/C10H4F7NO/c11-8(9(12,13)14,10(15,16)17)7-18-5-3-1-2-4-6(5)19-7/h1-4H |
| InChIKey | JVWPIFHJPCCKLB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.13 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |