C17H12N2O3 — CID 11231642
1,1-bis(1,3-benzoxazol-2-yl)prop-2-en-1-ol (PubChem CID 11231642) has the molecular formula C17H12N2O3 and a molecular weight of 292.29 g/mol. Its IUPAC name is 1,1-bis(1,3-benzoxazol-2-yl)prop-2-en-1-ol.
| Compound Name | 1,1-bis(1,3-benzoxazol-2-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 11231642 |
| Molecular Formula | C17H12N2O3 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 1,1-bis(1,3-benzoxazol-2-yl)prop-2-en-1-ol |
| SMILES | C=CC(O)(c1nc2ccccc2o1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C17H12N2O3/c1-2-17(20,15-18-11-7-3-5-9-13(11)21-15)16-19-12-8-4-6-10-14(12)22-16/h2-10,20H,1H2 |
| InChIKey | QCIMADXTJUYAFO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 72.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|