C9H6F3NO3 — CID 119082013
1-(1,3-benzoxazol-2-yl)-2,2,2-trifluoroethane-1,1-diol (PubChem CID 119082013) has the molecular formula C9H6F3NO3 and a molecular weight of 233.14 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-2,2,2-trifluoroethane-1,1-diol.
| Compound Name | 1-(1,3-benzoxazol-2-yl)-2,2,2-trifluoroethane-1,1-diol |
|---|---|
| PubChem CID | 119082013 |
| Molecular Formula | C9H6F3NO3 |
| Molecular Weight | 233.14 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)-2,2,2-trifluoroethane-1,1-diol |
| SMILES | OC(O)(c1nc2ccccc2o1)C(F)(F)F |
| InChI | InChI=1S/C9H6F3NO3/c10-9(11,12)8(14,15)7-13-5-3-1-2-4-6(5)16-7/h1-4,14-15H |
| InChIKey | IWJWDBNSECYUQW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.14 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|