C14H8ClF2N3O — CID 141476146
[1,3-benzoxazol-2-yl(difluoro)methyl]-(4-chlorophenyl)diazene (PubChem CID 141476146) has the molecular formula C14H8ClF2N3O and a molecular weight of 307.69 g/mol. Its IUPAC name is [1,3-benzoxazol-2-yl(difluoro)methyl]-(4-chlorophenyl)diazene.
| Compound Name | [1,3-benzoxazol-2-yl(difluoro)methyl]-(4-chlorophenyl)diazene |
|---|---|
| PubChem CID | 141476146 |
| Molecular Formula | C14H8ClF2N3O |
| Molecular Weight | 307.69 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | [1,3-benzoxazol-2-yl(difluoro)methyl]-(4-chlorophenyl)diazene |
| SMILES | FC(F)(/N=N/c1ccc(Cl)cc1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C14H8ClF2N3O/c15-9-5-7-10(8-6-9)19-20-14(16,17)13-18-11-3-1-2-4-12(11)21-13/h1-8H/b20-19+ |
| InChIKey | BMWZERJQECFBBR-FMQUCBEESA-N |
| XLogP | 5.31 |
| TPSA | 50.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.69 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|