C8H7N3O — CID 123718607
1,3-benzoxazol-2-yl(methyl)diazene (PubChem CID 123718607) has the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. Its IUPAC name is 1,3-benzoxazol-2-yl(methyl)diazene.
| Compound Name | 1,3-benzoxazol-2-yl(methyl)diazene |
|---|---|
| PubChem CID | 123718607 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | 1,3-benzoxazol-2-yl(methyl)diazene |
| SMILES | C/N=N/c1nc2ccccc2o1 |
| InChI | InChI=1S/C8H7N3O/c1-9-11-8-10-6-4-2-3-5-7(6)12-8/h2-5H,1H3/b11-9+ |
| InChIKey | PZOJAXZHJPJMMR-PKNBQFBNSA-N |
| XLogP | 2.54 |
| TPSA | 50.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|