C11H11NO — CID 86020978
2-but-2-enyl-1,3-benzoxazole (PubChem CID 86020978) has the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. Its IUPAC name is 2-but-2-enyl-1,3-benzoxazole.
| Compound Name | 2-but-2-enyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 86020978 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 2-but-2-enyl-1,3-benzoxazole |
| SMILES | CC=CCc1nc2ccccc2o1 |
| InChI | InChI=1S/C11H11NO/c1-2-3-8-11-12-9-6-4-5-7-10(9)13-11/h2-7H,8H2,1H3 |
| InChIKey | AKJQOYJWXBCNBM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|