C11H13NO — CID 178101004
2-methyl-1,3-benzoxazole;prop-1-ene (PubChem CID 178101004) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-methyl-1,3-benzoxazole;prop-1-ene.
| Compound Name | 2-methyl-1,3-benzoxazole;prop-1-ene |
|---|---|
| PubChem CID | 178101004 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 2-methyl-1,3-benzoxazole;prop-1-ene |
| SMILES | C=CC.Cc1nc2ccccc2o1 |
| InChI | InChI=1S/C8H7NO.C3H6/c1-6-9-7-4-2-3-5-8(7)10-6;1-3-2/h2-5H,1H3;3H,1H2,2H3 |
| InChIKey | WLCWQGLABNZJOK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|