C14H9NO2 — CID 20610547
2-methyl-[1]benzofuro[2,3-f][1,3]benzoxazole (PubChem CID 20610547) has the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. Its IUPAC name is 2-methyl-[1]benzofuro[2,3-f][1,3]benzoxazole.
| Compound Name | 2-methyl-[1]benzofuro[2,3-f][1,3]benzoxazole |
|---|---|
| PubChem CID | 20610547 |
| Molecular Formula | C14H9NO2 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 2-methyl-[1]benzofuro[2,3-f][1,3]benzoxazole |
| SMILES | Cc1nc2cc3oc4ccccc4c3cc2o1 |
| InChI | InChI=1S/C14H9NO2/c1-8-15-11-7-13-10(6-14(11)16-8)9-4-2-3-5-12(9)17-13/h2-7H,1H3 |
| InChIKey | QWXIDRLTZRLXLR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |