C13H5BrF3NO — CID 139662329
2-(3-bromo-2,4,5-trifluorophenyl)-1,3-benzoxazole (PubChem CID 139662329) has the molecular formula C13H5BrF3NO and a molecular weight of 328.09 g/mol. Its IUPAC name is 2-(3-bromo-2,4,5-trifluorophenyl)-1,3-benzoxazole.
| Compound Name | 2-(3-bromo-2,4,5-trifluorophenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 139662329 |
| Molecular Formula | C13H5BrF3NO |
| Molecular Weight | 328.09 g/mol |
| Exact Mass | 326.95 |
| IUPAC Name | 2-(3-bromo-2,4,5-trifluorophenyl)-1,3-benzoxazole |
| SMILES | Fc1cc(-c2nc3ccccc3o2)c(F)c(Br)c1F |
| InChI | InChI=1S/C13H5BrF3NO/c14-10-11(16)6(5-7(15)12(10)17)13-18-8-3-1-2-4-9(8)19-13/h1-5H |
| InChIKey | VTKSEFYMEMUWRL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.09 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|