C13H8Cl2N2O — CID 53419153
N-(3,5-dichlorophenyl)-1,3-benzoxazol-2-amine (PubChem CID 53419153) has the molecular formula C13H8Cl2N2O and a molecular weight of 279.13 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-1,3-benzoxazol-2-amine.
| Compound Name | N-(3,5-dichlorophenyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 53419153 |
| Molecular Formula | C13H8Cl2N2O |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | N-(3,5-dichlorophenyl)-1,3-benzoxazol-2-amine |
| SMILES | Clc1cc(Cl)cc(Nc2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C13H8Cl2N2O/c14-8-5-9(15)7-10(6-8)16-13-17-11-3-1-2-4-12(11)18-13/h1-7H,(H,16,17) |
| InChIKey | ORMFITUXSCBNKI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |