C15H11ClN2O2 — CID 90655333
N-(1,3-benzoxazol-2-yl)-2-(4-chlorophenyl)acetamide (PubChem CID 90655333) has the molecular formula C15H11ClN2O2 and a molecular weight of 286.72 g/mol. Its IUPAC name is N-(1,3-benzoxazol-2-yl)-2-(4-chlorophenyl)acetamide.
| Compound Name | N-(1,3-benzoxazol-2-yl)-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 90655333 |
| Molecular Formula | C15H11ClN2O2 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | N-(1,3-benzoxazol-2-yl)-2-(4-chlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)Nc1nc2ccccc2o1 |
| InChI | InChI=1S/C15H11ClN2O2/c16-11-7-5-10(6-8-11)9-14(19)18-15-17-12-3-1-2-4-13(12)20-15/h1-8H,9H2,(H,17,18,19) |
| InChIKey | WTYHHLUYXYYOKH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |