C21H21ClN4O3 — CID 46698256
1-(1,3-benzoxazol-2-yl)-N'-[2-(4-chlorophenyl)acetyl]piperidine-4-carbohydrazide (PubChem CID 46698256) has the molecular formula C21H21ClN4O3 and a molecular weight of 412.88 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-2-yl)-N'-[2-(4-chlorophenyl)acetyl]piperidine-4-carbohydrazide.
| Compound Name | 1-(1,3-benzoxazol-2-yl)-N'-[2-(4-chlorophenyl)acetyl]piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 46698256 |
| Molecular Formula | C21H21ClN4O3 |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 1-(1,3-benzoxazol-2-yl)-N'-[2-(4-chlorophenyl)acetyl]piperidine-4-carbohydrazide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NNC(=O)C1CCN(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C21H21ClN4O3/c22-16-7-5-14(6-8-16)13-19(27)24-25-20(28)15-9-11-26(12-10-15)21-23-17-3-1-2-4-18(17)29-21/h1-8,15H,9-13H2,(H,24,27)(H,25,28) |
| InChIKey | BPPUFTIXISNZJS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|