C19H26N2O — CID 90886573
ethane;N-(4-ethylphenyl)-1,3-benzoxazol-2-amine (PubChem CID 90886573) has the molecular formula C19H26N2O and a molecular weight of 298.43 g/mol. Its IUPAC name is ethane;N-(4-ethylphenyl)-1,3-benzoxazol-2-amine.
| Compound Name | ethane;N-(4-ethylphenyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 90886573 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | ethane;N-(4-ethylphenyl)-1,3-benzoxazol-2-amine |
| SMILES | CC.CC.CCc1ccc(Nc2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C15H14N2O.2C2H6/c1-2-11-7-9-12(10-8-11)16-15-17-13-5-3-4-6-14(13)18-15;2*1-2/h3-10H,2H2,1H3,(H,16,17);2*1-2H3 |
| InChIKey | QMRPBRLWLXUKHR-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |