C15H16N2O2 — CID 91286009
2-anilino-1,3-benzoxazol-6-ol;ethane (PubChem CID 91286009) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-anilino-1,3-benzoxazol-6-ol;ethane.
| Compound Name | 2-anilino-1,3-benzoxazol-6-ol;ethane |
|---|---|
| PubChem CID | 91286009 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-anilino-1,3-benzoxazol-6-ol;ethane |
| SMILES | CC.Oc1ccc2nc(Nc3ccccc3)oc2c1 |
| InChI | InChI=1S/C13H10N2O2.C2H6/c16-10-6-7-11-12(8-10)17-13(15-11)14-9-4-2-1-3-5-9;1-2/h1-8,16H,(H,14,15);1-2H3 |
| InChIKey | YSGKJTOXLHQOSJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |