C16H10N2O3 — CID 116690362
2-(3-ethynylanilino)-1,3-benzoxazole-6-carboxylic acid (PubChem CID 116690362) has the molecular formula C16H10N2O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is 2-(3-ethynylanilino)-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-(3-ethynylanilino)-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 116690362 |
| Molecular Formula | C16H10N2O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 2-(3-ethynylanilino)-1,3-benzoxazole-6-carboxylic acid |
| SMILES | C#Cc1cccc(Nc2nc3ccc(C(=O)O)cc3o2)c1 |
| InChI | InChI=1S/C16H10N2O3/c1-2-10-4-3-5-12(8-10)17-16-18-13-7-6-11(15(19)20)9-14(13)21-16/h1,3-9H,(H,17,18)(H,19,20) |
| InChIKey | TWCMGNFRFHDIML-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|