C13H9N3O4 — CID 142736200
2-(4-nitroanilino)-1,3-benzoxazol-5-ol (PubChem CID 142736200) has the molecular formula C13H9N3O4 and a molecular weight of 271.23 g/mol. Its IUPAC name is 2-(4-nitroanilino)-1,3-benzoxazol-5-ol.
| Compound Name | 2-(4-nitroanilino)-1,3-benzoxazol-5-ol |
|---|---|
| PubChem CID | 142736200 |
| Molecular Formula | C13H9N3O4 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-(4-nitroanilino)-1,3-benzoxazol-5-ol |
| SMILES | O=[N+]([O-])c1ccc(Nc2nc3cc(O)ccc3o2)cc1 |
| InChI | InChI=1S/C13H9N3O4/c17-10-5-6-12-11(7-10)15-13(20-12)14-8-1-3-9(4-2-8)16(18)19/h1-7,17H,(H,14,15) |
| InChIKey | RCFPCNGGHGKJRN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 101.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|