C13H9ClN4O3 — CID 79881200
4-chloro-3-N-(5-nitro-1,3-benzoxazol-2-yl)benzene-1,3-diamine (PubChem CID 79881200) has the molecular formula C13H9ClN4O3 and a molecular weight of 304.69 g/mol. Its IUPAC name is 4-chloro-3-N-(5-nitro-1,3-benzoxazol-2-yl)benzene-1,3-diamine.
| Compound Name | 4-chloro-3-N-(5-nitro-1,3-benzoxazol-2-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 79881200 |
| Molecular Formula | C13H9ClN4O3 |
| Molecular Weight | 304.69 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 4-chloro-3-N-(5-nitro-1,3-benzoxazol-2-yl)benzene-1,3-diamine |
| SMILES | Nc1ccc(Cl)c(Nc2nc3cc([N+](=O)[O-])ccc3o2)c1 |
| InChI | InChI=1S/C13H9ClN4O3/c14-9-3-1-7(15)5-10(9)16-13-17-11-6-8(18(19)20)2-4-12(11)21-13/h1-6H,15H2,(H,16,17) |
| InChIKey | ZOSBIAVSNVCYDZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.69 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|