C13H8N4O6 — CID 139785820
5-nitro-2-[(5-nitro-1,3-benzoxazol-2-yl)amino]phenol (PubChem CID 139785820) has the molecular formula C13H8N4O6 and a molecular weight of 316.23 g/mol. Its IUPAC name is 5-nitro-2-[(5-nitro-1,3-benzoxazol-2-yl)amino]phenol.
| Compound Name | 5-nitro-2-[(5-nitro-1,3-benzoxazol-2-yl)amino]phenol |
|---|---|
| PubChem CID | 139785820 |
| Molecular Formula | C13H8N4O6 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 5-nitro-2-[(5-nitro-1,3-benzoxazol-2-yl)amino]phenol |
| SMILES | O=[N+]([O-])c1ccc(Nc2nc3cc([N+](=O)[O-])ccc3o2)c(O)c1 |
| InChI | InChI=1S/C13H8N4O6/c18-11-6-8(17(21)22)1-3-9(11)14-13-15-10-5-7(16(19)20)2-4-12(10)23-13/h1-6,18H,(H,14,15) |
| InChIKey | ZPVAMJKIQBEBKB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 144.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|