About N-(5-chloro-1,3-benzoxazol-2-yl)-2-(4-nitroanilino)benzamide
N-(5-chloro-1,3-benzoxazol-2-yl)-2-(4-nitroanilino)benzamide (PubChem CID 70868027) has the molecular formula C20H13ClN4O4
and a molecular weight of 408.80 g/mol. Its IUPAC name is N-(5-chloro-1,3-benzoxazol-2-yl)-2-(4-nitroanilino)benzamide.
Molecular Properties
| Compound Name | N-(5-chloro-1,3-benzoxazol-2-yl)-2-(4-nitroanilino)benzamide |
| PubChem CID | 70868027 |
| Molecular Formula | C20H13ClN4O4 |
| Molecular Weight | 408.80 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | N-(5-chloro-1,3-benzoxazol-2-yl)-2-(4-nitroanilino)benzamide |
| SMILES | O=C(Nc1nc2cc(Cl)ccc2o1)c1ccccc1Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H13ClN4O4/c21-12-5-10-18-17(11-12)23-20(29-18)24-19(26)15-3-1-2-4-16(15)22-13-6-8-14(9-7-13)25(27)28/h1-11,22H,(H,23,24,26) |
| InChIKey | AXLFSVXNUGBIKK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.80 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(5-chloro-1,3-benzoxazol-2-yl)-2-(4-nitroanilino)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-chloro-1,3-benzoxazol-2-yl)-2-(4-nitroanilino)benzamide?
The IUPAC name of N-(5-chloro-1,3-benzoxazol-2-yl)-2-(4-nitroanilino)benzamide (CID 70868027) is N-(5-chloro-1,3-benzoxazol-2-yl)-2-(4-nitroanilino)benzamide.
What is the SMILES notation for N-(5-chloro-1,3-benzoxazol-2-yl)-2-(4-nitroanilino)benzamide?
The canonical SMILES for N-(5-chloro-1,3-benzoxazol-2-yl)-2-(4-nitroanilino)benzamide is O=C(Nc1nc2cc(Cl)ccc2o1)c1ccccc1Nc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of N-(5-chloro-1,3-benzoxazol-2-yl)-2-(4-nitroanilino)benzamide?
The InChIKey is AXLFSVXNUGBIKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13ClN4O4/c21-12-5-10-18-17(11-12)23-20(29-18)24-19(26)15-3-1-2-4-16(15)22-13-6-8-14(9-7-13)25(27)28/h1-11,22H,(H,23,24,26).
What are the key properties of N-(5-chloro-1,3-benzoxazol-2-yl)-2-(4-nitroanilino)benzamide?
N-(5-chloro-1,3-benzoxazol-2-yl)-2-(4-nitroanilino)benzamide has a molecular weight of 408.80 g/mol, XLogP of 5.39, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-chloro-1,3-benzoxazol-2-yl)-2-(4-nitroanilino)benzamide is sourced from PubChem (CID 70868027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).