C20H13ClN4O4 — CID 70868027
N-(5-chloro-1,3-benzoxazol-2-yl)-2-(4-nitroanilino)benzamide (PubChem CID 70868027) has the molecular formula C20H13ClN4O4 and a molecular weight of 408.80 g/mol. Its IUPAC name is N-(5-chloro-1,3-benzoxazol-2-yl)-2-(4-nitroanilino)benzamide.
| Compound Name | N-(5-chloro-1,3-benzoxazol-2-yl)-2-(4-nitroanilino)benzamide |
|---|---|
| PubChem CID | 70868027 |
| Molecular Formula | C20H13ClN4O4 |
| Molecular Weight | 408.80 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | N-(5-chloro-1,3-benzoxazol-2-yl)-2-(4-nitroanilino)benzamide |
| SMILES | O=C(Nc1nc2cc(Cl)ccc2o1)c1ccccc1Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H13ClN4O4/c21-12-5-10-18-17(11-12)23-20(29-18)24-19(26)15-3-1-2-4-16(15)22-13-6-8-14(9-7-13)25(27)28/h1-11,22H,(H,23,24,26) |
| InChIKey | AXLFSVXNUGBIKK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.80 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|