C20H11Cl2N3O4 — CID 3343969
N-[2-chloro-5-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-2-nitrobenzamide (PubChem CID 3343969) has the molecular formula C20H11Cl2N3O4 and a molecular weight of 428.23 g/mol. Its IUPAC name is N-[2-chloro-5-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-2-nitrobenzamide.
| Compound Name | N-[2-chloro-5-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 3343969 |
| Molecular Formula | C20H11Cl2N3O4 |
| Molecular Weight | 428.23 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | N-[2-chloro-5-(5-chloro-1,3-benzoxazol-2-yl)phenyl]-2-nitrobenzamide |
| SMILES | O=C(Nc1cc(-c2nc3cc(Cl)ccc3o2)ccc1Cl)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H11Cl2N3O4/c21-12-6-8-18-16(10-12)24-20(29-18)11-5-7-14(22)15(9-11)23-19(26)13-3-1-2-4-17(13)25(27)28/h1-10H,(H,23,26) |
| InChIKey | NRNLIHVBJDAYET-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.23 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|