C16H9ClN4O3 — CID 6089797
(E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-(4-nitroanilino)prop-2-enenitrile (PubChem CID 6089797) has the molecular formula C16H9ClN4O3 and a molecular weight of 340.73 g/mol. Its IUPAC name is (E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-(4-nitroanilino)prop-2-enenitrile.
| Compound Name | (E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-(4-nitroanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 6089797 |
| Molecular Formula | C16H9ClN4O3 |
| Molecular Weight | 340.73 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | (E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-(4-nitroanilino)prop-2-enenitrile |
| SMILES | N#C/C(=C\Nc1ccc([N+](=O)[O-])cc1)c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C16H9ClN4O3/c17-11-1-6-15-14(7-11)20-16(24-15)10(8-18)9-19-12-2-4-13(5-3-12)21(22)23/h1-7,9,19H/b10-9+ |
| InChIKey | OGMOVFZQNLFRTC-MDZDMXLPSA-N |
| XLogP | 4.37 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.73 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|