C18H15ClN2O5S — CID 2247642
(E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-[4-(2-hydroxyethylsulfonyl)anilino]prop-2-enal (PubChem CID 2247642) has the molecular formula C18H15ClN2O5S and a molecular weight of 406.85 g/mol. Its IUPAC name is (E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-[4-(2-hydroxyethylsulfonyl)anilino]prop-2-enal.
| Compound Name | (E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-[4-(2-hydroxyethylsulfonyl)anilino]prop-2-enal |
|---|---|
| PubChem CID | 2247642 |
| Molecular Formula | C18H15ClN2O5S |
| Molecular Weight | 406.85 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | (E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-[4-(2-hydroxyethylsulfonyl)anilino]prop-2-enal |
| SMILES | O=C/C(=C/Nc1ccc(S(=O)(=O)CCO)cc1)c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C18H15ClN2O5S/c19-13-1-6-17-16(9-13)21-18(26-17)12(11-23)10-20-14-2-4-15(5-3-14)27(24,25)8-7-22/h1-6,9-11,20,22H,7-8H2/b12-10- |
| InChIKey | LNJHCCQLDOEINL-BENRWUELSA-N |
| XLogP | 2.90 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.85 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|