C16H9Cl2N3O4 — CID 4136963
2-(5-chloro-1,3-benzoxazol-2-yl)-3-(4-chloro-2-nitroanilino)prop-2-enal (PubChem CID 4136963) has the molecular formula C16H9Cl2N3O4 and a molecular weight of 378.17 g/mol. Its IUPAC name is 2-(5-chloro-1,3-benzoxazol-2-yl)-3-(4-chloro-2-nitroanilino)prop-2-enal.
| Compound Name | 2-(5-chloro-1,3-benzoxazol-2-yl)-3-(4-chloro-2-nitroanilino)prop-2-enal |
|---|---|
| PubChem CID | 4136963 |
| Molecular Formula | C16H9Cl2N3O4 |
| Molecular Weight | 378.17 g/mol |
| Exact Mass | 377.00 |
| IUPAC Name | 2-(5-chloro-1,3-benzoxazol-2-yl)-3-(4-chloro-2-nitroanilino)prop-2-enal |
| SMILES | O=CC(=CNc1ccc(Cl)cc1[N+](=O)[O-])c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C16H9Cl2N3O4/c17-10-2-4-15-13(5-10)20-16(25-15)9(8-22)7-19-12-3-1-11(18)6-14(12)21(23)24/h1-8,19H |
| InChIKey | FTEFWFNPMCDRLB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.17 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|