C22H15BrClN3O4S — CID 18528497
N-(4-bromophenyl)-4-[[(E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-oxoprop-1-enyl]amino]benzenesulfonamide (PubChem CID 18528497) has the molecular formula C22H15BrClN3O4S and a molecular weight of 532.80 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-[[(E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-oxoprop-1-enyl]amino]benzenesulfonamide.
| Compound Name | N-(4-bromophenyl)-4-[[(E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-oxoprop-1-enyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 18528497 |
| Molecular Formula | C22H15BrClN3O4S |
| Molecular Weight | 532.80 g/mol |
| Exact Mass | 530.97 |
| IUPAC Name | N-(4-bromophenyl)-4-[[(E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-oxoprop-1-enyl]amino]benzenesulfonamide |
| SMILES | O=C/C(=C/Nc1ccc(S(=O)(=O)Nc2ccc(Br)cc2)cc1)c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C22H15BrClN3O4S/c23-15-1-4-18(5-2-15)27-32(29,30)19-8-6-17(7-9-19)25-12-14(13-28)22-26-20-11-16(24)3-10-21(20)31-22/h1-13,25,27H/b14-12- |
| InChIKey | AKUONWPJZJAOJX-OWBHPGMISA-N |
| XLogP | 5.70 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.80 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|