C24H21N3O5S — CID 4162100
4-[[2-(1,3-benzoxazol-2-yl)-3-oxoprop-1-enyl]amino]-3-methoxy-N-(4-methylphenyl)benzenesulfonamide (PubChem CID 4162100) has the molecular formula C24H21N3O5S and a molecular weight of 463.52 g/mol. Its IUPAC name is 4-[[2-(1,3-benzoxazol-2-yl)-3-oxoprop-1-enyl]amino]-3-methoxy-N-(4-methylphenyl)benzenesulfonamide.
| Compound Name | 4-[[2-(1,3-benzoxazol-2-yl)-3-oxoprop-1-enyl]amino]-3-methoxy-N-(4-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 4162100 |
| Molecular Formula | C24H21N3O5S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 4-[[2-(1,3-benzoxazol-2-yl)-3-oxoprop-1-enyl]amino]-3-methoxy-N-(4-methylphenyl)benzenesulfonamide |
| SMILES | COc1cc(S(=O)(=O)Nc2ccc(C)cc2)ccc1NC=C(C=O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C24H21N3O5S/c1-16-7-9-18(10-8-16)27-33(29,30)19-11-12-20(23(13-19)31-2)25-14-17(15-28)24-26-21-5-3-4-6-22(21)32-24/h3-15,25,27H,1-2H3 |
| InChIKey | WEKQBSLGMXVGDI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|