C10H7NO3 — CID 2735197
(Z)-2-(1,3-benzoxazol-2-yl)-3-hydroxyprop-2-enal (PubChem CID 2735197) has the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. Its IUPAC name is (Z)-2-(1,3-benzoxazol-2-yl)-3-hydroxyprop-2-enal.
| Compound Name | (Z)-2-(1,3-benzoxazol-2-yl)-3-hydroxyprop-2-enal |
|---|---|
| PubChem CID | 2735197 |
| Molecular Formula | C10H7NO3 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | (Z)-2-(1,3-benzoxazol-2-yl)-3-hydroxyprop-2-enal |
| SMILES | O=C/C(=C\O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C10H7NO3/c12-5-7(6-13)10-11-8-3-1-2-4-9(8)14-10/h1-6,12H/b7-5+ |
| InChIKey | VVZCSOSKVMPQHF-FNORWQNLSA-N |
| XLogP | 1.93 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|