C9H8N4O2 — CID 155671130
N-(diaminomethylidene)-1,3-benzoxazole-2-carboxamide (PubChem CID 155671130) has the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. Its IUPAC name is N-(diaminomethylidene)-1,3-benzoxazole-2-carboxamide.
| Compound Name | N-(diaminomethylidene)-1,3-benzoxazole-2-carboxamide |
|---|---|
| PubChem CID | 155671130 |
| Molecular Formula | C9H8N4O2 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | N-(diaminomethylidene)-1,3-benzoxazole-2-carboxamide |
| SMILES | NC(N)=NC(=O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C9H8N4O2/c10-9(11)13-7(14)8-12-5-3-1-2-4-6(5)15-8/h1-4H,(H4,10,11,13,14) |
| InChIKey | DHRNOFAIQADTEX-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|