C12H10N6O2 — CID 138740832
N-(4,6-diaminopyrimidin-5-yl)-1,3-benzoxazole-2-carboxamide (PubChem CID 138740832) has the molecular formula C12H10N6O2 and a molecular weight of 270.25 g/mol. Its IUPAC name is N-(4,6-diaminopyrimidin-5-yl)-1,3-benzoxazole-2-carboxamide.
| Compound Name | N-(4,6-diaminopyrimidin-5-yl)-1,3-benzoxazole-2-carboxamide |
|---|---|
| PubChem CID | 138740832 |
| Molecular Formula | C12H10N6O2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | N-(4,6-diaminopyrimidin-5-yl)-1,3-benzoxazole-2-carboxamide |
| SMILES | Nc1ncnc(N)c1NC(=O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C12H10N6O2/c13-9-8(10(14)16-5-15-9)18-11(19)12-17-6-3-1-2-4-7(6)20-12/h1-5H,(H,18,19)(H4,13,14,15,16) |
| InChIKey | KBLXODITLVFYNU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 132.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |