C12H14N2O4 — CID 15441221
N-(2,2-dimethoxyethyl)-1,3-benzoxazole-2-carboxamide (PubChem CID 15441221) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-1,3-benzoxazole-2-carboxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-1,3-benzoxazole-2-carboxamide |
|---|---|
| PubChem CID | 15441221 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-1,3-benzoxazole-2-carboxamide |
| SMILES | COC(CNC(=O)c1nc2ccccc2o1)OC |
| InChI | InChI=1S/C12H14N2O4/c1-16-10(17-2)7-13-11(15)12-14-8-5-3-4-6-9(8)18-12/h3-6,10H,7H2,1-2H3,(H,13,15) |
| InChIKey | YDZJUGFCZIKAIF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|