C8H6N2O2S2 — CID 88578611
N-sulfanyloxy-1,3-benzoxazole-2-carbothioamide (PubChem CID 88578611) has the molecular formula C8H6N2O2S2 and a molecular weight of 226.28 g/mol. Its IUPAC name is N-sulfanyloxy-1,3-benzoxazole-2-carbothioamide.
| Compound Name | N-sulfanyloxy-1,3-benzoxazole-2-carbothioamide |
|---|---|
| PubChem CID | 88578611 |
| Molecular Formula | C8H6N2O2S2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | N-sulfanyloxy-1,3-benzoxazole-2-carbothioamide |
| SMILES | S=C(NOS)c1nc2ccccc2o1 |
| InChI | InChI=1S/C8H6N2O2S2/c13-8(10-12-14)7-9-5-3-1-2-4-6(5)11-7/h1-4,14H,(H,10,13) |
| InChIKey | WRVFSAZGUFSBBC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|