C14H10N2O2 — CID 137201316
N-[1,3-benzoxazol-2-yl(phenyl)methylidene]hydroxylamine (PubChem CID 137201316) has the molecular formula C14H10N2O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is N-[1,3-benzoxazol-2-yl(phenyl)methylidene]hydroxylamine.
| Compound Name | N-[1,3-benzoxazol-2-yl(phenyl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 137201316 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | N-[1,3-benzoxazol-2-yl(phenyl)methylidene]hydroxylamine |
| SMILES | ON=C(c1ccccc1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C14H10N2O2/c17-16-13(10-6-2-1-3-7-10)14-15-11-8-4-5-9-12(11)18-14/h1-9,17H |
| InChIKey | XNVXBJFGITVHSE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|