C26H23NO2 — CID 2913292
2-(1,3-benzoxazol-2-yl)-3-(4-tert-butylphenyl)-1-phenylprop-2-en-1-one (PubChem CID 2913292) has the molecular formula C26H23NO2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-3-(4-tert-butylphenyl)-1-phenylprop-2-en-1-one.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-3-(4-tert-butylphenyl)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 2913292 |
| Molecular Formula | C26H23NO2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-3-(4-tert-butylphenyl)-1-phenylprop-2-en-1-one |
| SMILES | CC(C)(C)c1ccc(C=C(C(=O)c2ccccc2)c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C26H23NO2/c1-26(2,3)20-15-13-18(14-16-20)17-21(24(28)19-9-5-4-6-10-19)25-27-22-11-7-8-12-23(22)29-25/h4-17H,1-3H3 |
| InChIKey | LCDILZZCRPNBIK-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|