C21H20NO3- — CID 7986829
(E)-3-(1,3-benzoxazol-2-yl)-4-(4-tert-butylphenyl)but-3-enoate (PubChem CID 7986829) has the molecular formula C21H20NO3- and a molecular weight of 334.40 g/mol. Its IUPAC name is (E)-3-(1,3-benzoxazol-2-yl)-4-(4-tert-butylphenyl)but-3-enoate.
| Compound Name | (E)-3-(1,3-benzoxazol-2-yl)-4-(4-tert-butylphenyl)but-3-enoate |
|---|---|
| PubChem CID | 7986829 |
| Molecular Formula | C21H20NO3- |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (E)-3-(1,3-benzoxazol-2-yl)-4-(4-tert-butylphenyl)but-3-enoate |
| SMILES | CC(C)(C)c1ccc(/C=C(\CC(=O)[O-])c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C21H21NO3/c1-21(2,3)16-10-8-14(9-11-16)12-15(13-19(23)24)20-22-17-6-4-5-7-18(17)25-20/h4-12H,13H2,1-3H3,(H,23,24)/p-1/b15-12+ |
| InChIKey | DFIHOZBZGKATFM-NTCAYCPXSA-M |
| XLogP | 3.81 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |