C17H11ClNO4- — CID 9039035
2-[4-[(Z)-2-(1,3-benzoxazol-2-yl)-2-chloroethenyl]phenoxy]acetate (PubChem CID 9039035) has the molecular formula C17H11ClNO4- and a molecular weight of 328.73 g/mol. Its IUPAC name is 2-[4-[(Z)-2-(1,3-benzoxazol-2-yl)-2-chloroethenyl]phenoxy]acetate.
| Compound Name | 2-[4-[(Z)-2-(1,3-benzoxazol-2-yl)-2-chloroethenyl]phenoxy]acetate |
|---|---|
| PubChem CID | 9039035 |
| Molecular Formula | C17H11ClNO4- |
| Molecular Weight | 328.73 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-[4-[(Z)-2-(1,3-benzoxazol-2-yl)-2-chloroethenyl]phenoxy]acetate |
| SMILES | O=C([O-])COc1ccc(/C=C(\Cl)c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C17H12ClNO4/c18-13(17-19-14-3-1-2-4-15(14)23-17)9-11-5-7-12(8-6-11)22-10-16(20)21/h1-9H,10H2,(H,20,21)/p-1/b13-9- |
| InChIKey | OHESMODQEXIBJR-LCYFTJDESA-M |
| XLogP | 2.69 |
| TPSA | 75.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.73 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |