C23H16NO4S- — CID 8705502
(E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(4-phenylmethoxyphenyl)prop-2-enoate (PubChem CID 8705502) has the molecular formula C23H16NO4S- and a molecular weight of 402.45 g/mol. Its IUPAC name is (E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(4-phenylmethoxyphenyl)prop-2-enoate.
| Compound Name | (E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(4-phenylmethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8705502 |
| Molecular Formula | C23H16NO4S- |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | (E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(4-phenylmethoxyphenyl)prop-2-enoate |
| SMILES | O=C([O-])/C(=C\c1ccc(OCc2ccccc2)cc1)Sc1nc2ccccc2o1 |
| InChI | InChI=1S/C23H17NO4S/c25-22(26)21(29-23-24-19-8-4-5-9-20(19)28-23)14-16-10-12-18(13-11-16)27-15-17-6-2-1-3-7-17/h1-14H,15H2,(H,25,26)/p-1/b21-14+ |
| InChIKey | GKGHNDFITXTJOW-KGENOOAVSA-M |
| XLogP | 4.29 |
| TPSA | 75.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|