C16H8Cl2NO3S- — CID 8705776
(Z)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(2,3-dichlorophenyl)prop-2-enoate (PubChem CID 8705776) has the molecular formula C16H8Cl2NO3S- and a molecular weight of 365.22 g/mol. Its IUPAC name is (Z)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(2,3-dichlorophenyl)prop-2-enoate.
| Compound Name | (Z)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(2,3-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8705776 |
| Molecular Formula | C16H8Cl2NO3S- |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 363.96 |
| IUPAC Name | (Z)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-(2,3-dichlorophenyl)prop-2-enoate |
| SMILES | O=C([O-])/C(=C/c1cccc(Cl)c1Cl)Sc1nc2ccccc2o1 |
| InChI | InChI=1S/C16H9Cl2NO3S/c17-10-5-3-4-9(14(10)18)8-13(15(20)21)23-16-19-11-6-1-2-7-12(11)22-16/h1-8H,(H,20,21)/p-1/b13-8- |
| InChIKey | KXXGVFCTCGVBTI-JYRVWZFOSA-M |
| XLogP | 4.02 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|