C20H12ClNO4S — CID 8705472
(E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-[5-(3-chlorophenyl)furan-2-yl]prop-2-enoic acid (PubChem CID 8705472) has the molecular formula C20H12ClNO4S and a molecular weight of 397.84 g/mol. Its IUPAC name is (E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-[5-(3-chlorophenyl)furan-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-[5-(3-chlorophenyl)furan-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 8705472 |
| Molecular Formula | C20H12ClNO4S |
| Molecular Weight | 397.84 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | (E)-2-(1,3-benzoxazol-2-ylsulfanyl)-3-[5-(3-chlorophenyl)furan-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1ccc(-c2cccc(Cl)c2)o1)Sc1nc2ccccc2o1 |
| InChI | InChI=1S/C20H12ClNO4S/c21-13-5-3-4-12(10-13)16-9-8-14(25-16)11-18(19(23)24)27-20-22-15-6-1-2-7-17(15)26-20/h1-11H,(H,23,24)/b18-11+ |
| InChIKey | KRWKFIWMJLYCDX-WOJGMQOQSA-N |
| XLogP | 5.96 |
| TPSA | 76.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.84 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|