C16H10ClN2O4S- — CID 8706267
(E)-3-[5-(3-chlorophenyl)furan-2-yl]-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoate (PubChem CID 8706267) has the molecular formula C16H10ClN2O4S- and a molecular weight of 361.79 g/mol. Its IUPAC name is (E)-3-[5-(3-chlorophenyl)furan-2-yl]-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoate.
| Compound Name | (E)-3-[5-(3-chlorophenyl)furan-2-yl]-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoate |
|---|---|
| PubChem CID | 8706267 |
| Molecular Formula | C16H10ClN2O4S- |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | (E)-3-[5-(3-chlorophenyl)furan-2-yl]-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoate |
| SMILES | Cc1nnc(S/C(=C/c2ccc(-c3cccc(Cl)c3)o2)C(=O)[O-])o1 |
| InChI | InChI=1S/C16H11ClN2O4S/c1-9-18-19-16(22-9)24-14(15(20)21)8-12-5-6-13(23-12)10-3-2-4-11(17)7-10/h2-8H,1H3,(H,20,21)/p-1/b14-8+ |
| InChIKey | VLOQIABYEZDYQU-RIYZIHGNSA-M |
| XLogP | 3.17 |
| TPSA | 92.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|