C13H11N2O3S- — CID 8706478
(Z)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-(4-methylphenyl)prop-2-enoate (PubChem CID 8706478) has the molecular formula C13H11N2O3S- and a molecular weight of 275.31 g/mol. Its IUPAC name is (Z)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-(4-methylphenyl)prop-2-enoate.
| Compound Name | (Z)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8706478 |
| Molecular Formula | C13H11N2O3S- |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | (Z)-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-3-(4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C(\Sc2nnc(C)o2)C(=O)[O-])cc1 |
| InChI | InChI=1S/C13H12N2O3S/c1-8-3-5-10(6-4-8)7-11(12(16)17)19-13-15-14-9(2)18-13/h3-7H,1-2H3,(H,16,17)/p-1/b11-7- |
| InChIKey | XVFLXQKYNUILBZ-XFFZJAGNSA-M |
| XLogP | 1.57 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|