C13H11N2O5S- — CID 54716100
5-[(Z)-2-carboxy-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethenyl]-2-methoxyphenolate (PubChem CID 54716100) has the molecular formula C13H11N2O5S- and a molecular weight of 307.31 g/mol. Its IUPAC name is 5-[(Z)-2-carboxy-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethenyl]-2-methoxyphenolate.
| Compound Name | 5-[(Z)-2-carboxy-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethenyl]-2-methoxyphenolate |
|---|---|
| PubChem CID | 54716100 |
| Molecular Formula | C13H11N2O5S- |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 5-[(Z)-2-carboxy-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethenyl]-2-methoxyphenolate |
| SMILES | COc1ccc(/C=C(\Sc2nnc(C)o2)C(=O)O)cc1[O-] |
| InChI | InChI=1S/C13H12N2O5S/c1-7-14-15-13(20-7)21-11(12(17)18)6-8-3-4-10(19-2)9(16)5-8/h3-6,16H,1-2H3,(H,17,18)/p-1/b11-6- |
| InChIKey | YZHGYGGLHZPACX-WDZFZDKYSA-M |
| XLogP | 1.68 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|