C14H12N2O6S — CID 8706604
(Z)-3-[3-(carboxymethoxy)phenyl]-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoic acid (PubChem CID 8706604) has the molecular formula C14H12N2O6S and a molecular weight of 336.33 g/mol. Its IUPAC name is (Z)-3-[3-(carboxymethoxy)phenyl]-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoic acid.
| Compound Name | (Z)-3-[3-(carboxymethoxy)phenyl]-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 8706604 |
| Molecular Formula | C14H12N2O6S |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | (Z)-3-[3-(carboxymethoxy)phenyl]-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]prop-2-enoic acid |
| SMILES | Cc1nnc(S/C(=C\c2cccc(OCC(=O)O)c2)C(=O)O)o1 |
| InChI | InChI=1S/C14H12N2O6S/c1-8-15-16-14(22-8)23-11(13(19)20)6-9-3-2-4-10(5-9)21-7-12(17)18/h2-6H,7H2,1H3,(H,17,18)(H,19,20)/b11-6- |
| InChIKey | VUBXLDBZGXPKJK-WDZFZDKYSA-N |
| XLogP | 2.06 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|