C19H16N2O6S — CID 124651744
(Z)-2-[[5-(3,5-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-(3-hydroxyphenyl)prop-2-enoic acid (PubChem CID 124651744) has the molecular formula C19H16N2O6S and a molecular weight of 400.41 g/mol. Its IUPAC name is (Z)-2-[[5-(3,5-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-(3-hydroxyphenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-[[5-(3,5-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-(3-hydroxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 124651744 |
| Molecular Formula | C19H16N2O6S |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | (Z)-2-[[5-(3,5-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-3-(3-hydroxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc(OC)cc(-c2nnc(S/C(=C\c3cccc(O)c3)C(=O)O)o2)c1 |
| InChI | InChI=1S/C19H16N2O6S/c1-25-14-8-12(9-15(10-14)26-2)17-20-21-19(27-17)28-16(18(23)24)7-11-4-3-5-13(22)6-11/h3-10,22H,1-2H3,(H,23,24)/b16-7- |
| InChIKey | YRFBHILTOUTMTM-APSNUPSMSA-N |
| XLogP | 3.68 |
| TPSA | 114.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|