C18H11F3N2O4S — CID 6387124
(E)-3-[4-(difluoromethoxy)phenyl]-2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]prop-2-enoic acid (PubChem CID 6387124) has the molecular formula C18H11F3N2O4S and a molecular weight of 408.36 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)phenyl]-2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(difluoromethoxy)phenyl]-2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 6387124 |
| Molecular Formula | C18H11F3N2O4S |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)phenyl]-2-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]prop-2-enoic acid |
| SMILES | O=C(O)/C(=C\c1ccc(OC(F)F)cc1)Sc1nnc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C18H11F3N2O4S/c19-12-5-3-11(4-6-12)15-22-23-18(27-15)28-14(16(24)25)9-10-1-7-13(8-2-10)26-17(20)21/h1-9,17H,(H,24,25)/b14-9+ |
| InChIKey | JSSOIMCPZGUCAP-NTEUORMPSA-N |
| XLogP | 4.69 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|