C13H12F2N2O4S — CID 139557932
4-[[5-[4-(difluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]butanoic acid (PubChem CID 139557932) has the molecular formula C13H12F2N2O4S and a molecular weight of 330.31 g/mol. Its IUPAC name is 4-[[5-[4-(difluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]butanoic acid.
| Compound Name | 4-[[5-[4-(difluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]butanoic acid |
|---|---|
| PubChem CID | 139557932 |
| Molecular Formula | C13H12F2N2O4S |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 4-[[5-[4-(difluoromethoxy)phenyl]-1,3,4-oxadiazol-2-yl]sulfanyl]butanoic acid |
| SMILES | O=C(O)CCCSc1nnc(-c2ccc(OC(F)F)cc2)o1 |
| InChI | InChI=1S/C13H12F2N2O4S/c14-12(15)20-9-5-3-8(4-6-9)11-16-17-13(21-11)22-7-1-2-10(18)19/h3-6,12H,1-2,7H2,(H,18,19) |
| InChIKey | RHJGCPLEKJBNCB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|